C12H14F2N4O2S — CID 64518395
5-(difluoromethylsulfanylmethyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]furan-2-carboxamide (PubChem CID 64518395) has the molecular formula C12H14F2N4O2S and a molecular weight of 316.33 g/mol. Its IUPAC name is 5-(difluoromethylsulfanylmethyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]furan-2-carboxamide.
| Compound Name | 5-(difluoromethylsulfanylmethyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 64518395 |
| Molecular Formula | C12H14F2N4O2S |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 5-(difluoromethylsulfanylmethyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]furan-2-carboxamide |
| SMILES | O=C(NCCCc1ncn[nH]1)c1ccc(CSC(F)F)o1 |
| InChI | InChI=1S/C12H14F2N4O2S/c13-12(14)21-6-8-3-4-9(20-8)11(19)15-5-1-2-10-16-7-17-18-10/h3-4,7,12H,1-2,5-6H2,(H,15,19)(H,16,17,18) |
| InChIKey | HLYHZHZTEIHNCG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|