About methyl 3-[[2-(3-methylimidazo[4,5-b]pyridin-2-yl)sulfanylacetyl]amino]benzoate
methyl 3-[[2-(3-methylimidazo[4,5-b]pyridin-2-yl)sulfanylacetyl]amino]benzoate (PubChem CID 645185) has the molecular formula C17H16N4O3S
and a molecular weight of 356.41 g/mol. Its IUPAC name is methyl 3-[[2-(3-methylimidazo[4,5-b]pyridin-2-yl)sulfanylacetyl]amino]benzoate.
Molecular Properties
| Compound Name | methyl 3-[[2-(3-methylimidazo[4,5-b]pyridin-2-yl)sulfanylacetyl]amino]benzoate |
| PubChem CID | 645185 |
| Molecular Formula | C17H16N4O3S |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | methyl 3-[[2-(3-methylimidazo[4,5-b]pyridin-2-yl)sulfanylacetyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)CSc2nc3cccnc3n2C)c1 |
| InChI | InChI=1S/C17H16N4O3S/c1-21-15-13(7-4-8-18-15)20-17(21)25-10-14(22)19-12-6-3-5-11(9-12)16(23)24-2/h3-9H,10H2,1-2H3,(H,19,22) |
| InChIKey | LSBATUITNJQOCI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 3-[[2-(3-methylimidazo[4,5-b]pyridin-2-yl)sulfanylacetyl]amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[[2-(3-methylimidazo[4,5-b]pyridin-2-yl)sulfanylacetyl]amino]benzoate?
The IUPAC name of methyl 3-[[2-(3-methylimidazo[4,5-b]pyridin-2-yl)sulfanylacetyl]amino]benzoate (CID 645185) is methyl 3-[[2-(3-methylimidazo[4,5-b]pyridin-2-yl)sulfanylacetyl]amino]benzoate.
What is the SMILES notation for methyl 3-[[2-(3-methylimidazo[4,5-b]pyridin-2-yl)sulfanylacetyl]amino]benzoate?
The canonical SMILES for methyl 3-[[2-(3-methylimidazo[4,5-b]pyridin-2-yl)sulfanylacetyl]amino]benzoate is COC(=O)c1cccc(NC(=O)CSc2nc3cccnc3n2C)c1.
What is the InChIKey of methyl 3-[[2-(3-methylimidazo[4,5-b]pyridin-2-yl)sulfanylacetyl]amino]benzoate?
The InChIKey is LSBATUITNJQOCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4O3S/c1-21-15-13(7-4-8-18-15)20-17(21)25-10-14(22)19-12-6-3-5-11(9-12)16(23)24-2/h3-9H,10H2,1-2H3,(H,19,22).
What are the key properties of methyl 3-[[2-(3-methylimidazo[4,5-b]pyridin-2-yl)sulfanylacetyl]amino]benzoate?
methyl 3-[[2-(3-methylimidazo[4,5-b]pyridin-2-yl)sulfanylacetyl]amino]benzoate has a molecular weight of 356.41 g/mol, XLogP of 2.49, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[[2-(3-methylimidazo[4,5-b]pyridin-2-yl)sulfanylacetyl]amino]benzoate is sourced from PubChem (CID 645185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).