About 4-cyano-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)oxane-4-carboxamide
4-cyano-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)oxane-4-carboxamide (PubChem CID 64518659) has the molecular formula C11H15N5O2
and a molecular weight of 249.27 g/mol. Its IUPAC name is 4-cyano-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)oxane-4-carboxamide.
Molecular Properties
| Compound Name | 4-cyano-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)oxane-4-carboxamide |
| PubChem CID | 64518659 |
| Molecular Formula | C11H15N5O2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 4-cyano-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)oxane-4-carboxamide |
| SMILES | CN(Cc1ncn[nH]1)C(=O)C1(C#N)CCOCC1 |
| InChI | InChI=1S/C11H15N5O2/c1-16(6-9-13-8-14-15-9)10(17)11(7-12)2-4-18-5-3-11/h8H,2-6H2,1H3,(H,13,14,15) |
| InChIKey | XVVDMBJPNVBSBI-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 94.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-cyano-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)oxane-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyano-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)oxane-4-carboxamide?
The IUPAC name of 4-cyano-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)oxane-4-carboxamide (CID 64518659) is 4-cyano-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)oxane-4-carboxamide.
What is the SMILES notation for 4-cyano-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)oxane-4-carboxamide?
The canonical SMILES for 4-cyano-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)oxane-4-carboxamide is CN(Cc1ncn[nH]1)C(=O)C1(C#N)CCOCC1.
What is the InChIKey of 4-cyano-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)oxane-4-carboxamide?
The InChIKey is XVVDMBJPNVBSBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N5O2/c1-16(6-9-13-8-14-15-9)10(17)11(7-12)2-4-18-5-3-11/h8H,2-6H2,1H3,(H,13,14,15).
What are the key properties of 4-cyano-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)oxane-4-carboxamide?
4-cyano-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)oxane-4-carboxamide has a molecular weight of 249.27 g/mol, XLogP of 0.08, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyano-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)oxane-4-carboxamide is sourced from PubChem (CID 64518659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).