About 2-aminoethanol;1,2-dihydropyridazine-3,6-dione
2-aminoethanol;1,2-dihydropyridazine-3,6-dione (PubChem CID 6451887) has the molecular formula C6H11N3O3
and a molecular weight of 173.17 g/mol. Its IUPAC name is 2-aminoethanol;1,2-dihydropyridazine-3,6-dione.
Molecular Properties
| Compound Name | 2-aminoethanol;1,2-dihydropyridazine-3,6-dione |
| PubChem CID | 6451887 |
| Molecular Formula | C6H11N3O3 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 2-aminoethanol;1,2-dihydropyridazine-3,6-dione |
| SMILES | NCCO.O=c1ccc(=O)[nH][nH]1 |
| InChI | InChI=1S/C4H4N2O2.C2H7NO/c7-3-1-2-4(8)6-5-3;3-1-2-4/h1-2H,(H,5,7)(H,6,8);4H,1-3H2 |
| InChIKey | ZRUUKURQYAUHQQ-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-aminoethanol;1,2-dihydropyridazine-3,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethanol;1,2-dihydropyridazine-3,6-dione?
The IUPAC name of 2-aminoethanol;1,2-dihydropyridazine-3,6-dione (CID 6451887) is 2-aminoethanol;1,2-dihydropyridazine-3,6-dione.
What is the SMILES notation for 2-aminoethanol;1,2-dihydropyridazine-3,6-dione?
The canonical SMILES for 2-aminoethanol;1,2-dihydropyridazine-3,6-dione is NCCO.O=c1ccc(=O)[nH][nH]1.
What is the InChIKey of 2-aminoethanol;1,2-dihydropyridazine-3,6-dione?
The InChIKey is ZRUUKURQYAUHQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2O2.C2H7NO/c7-3-1-2-4(8)6-5-3;3-1-2-4/h1-2H,(H,5,7)(H,6,8);4H,1-3H2.
What are the key properties of 2-aminoethanol;1,2-dihydropyridazine-3,6-dione?
2-aminoethanol;1,2-dihydropyridazine-3,6-dione has a molecular weight of 173.17 g/mol, XLogP of -2.00, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethanol;1,2-dihydropyridazine-3,6-dione is sourced from PubChem (CID 6451887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).