C9H15N5O3 — CID 64519264
4-[[methyl(1H-1,2,4-triazol-5-ylmethyl)carbamoyl]amino]butanoic acid (PubChem CID 64519264) has the molecular formula C9H15N5O3 and a molecular weight of 241.25 g/mol. Its IUPAC name is 4-[[methyl(1H-1,2,4-triazol-5-ylmethyl)carbamoyl]amino]butanoic acid.
| Compound Name | 4-[[methyl(1H-1,2,4-triazol-5-ylmethyl)carbamoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 64519264 |
| Molecular Formula | C9H15N5O3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 4-[[methyl(1H-1,2,4-triazol-5-ylmethyl)carbamoyl]amino]butanoic acid |
| SMILES | CN(Cc1ncn[nH]1)C(=O)NCCCC(=O)O |
| InChI | InChI=1S/C9H15N5O3/c1-14(5-7-11-6-12-13-7)9(17)10-4-2-3-8(15)16/h6H,2-5H2,1H3,(H,10,17)(H,15,16)(H,11,12,13) |
| InChIKey | WENWIQIYUAKDMV-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|