About (2S)-2,5-diaminopentanoic acid;(2S)-5-oxopyrrolidine-2-carboxylic acid
(2S)-2,5-diaminopentanoic acid;(2S)-5-oxopyrrolidine-2-carboxylic acid (PubChem CID 6451930) has the molecular formula C10H19N3O5
and a molecular weight of 261.28 g/mol. Its IUPAC name is (2S)-2,5-diaminopentanoic acid;(2S)-5-oxopyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | (2S)-2,5-diaminopentanoic acid;(2S)-5-oxopyrrolidine-2-carboxylic acid |
| PubChem CID | 6451930 |
| Molecular Formula | C10H19N3O5 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | (2S)-2,5-diaminopentanoic acid;(2S)-5-oxopyrrolidine-2-carboxylic acid |
| SMILES | NCCC[C@H](N)C(=O)O.O=C1CC[C@@H](C(=O)O)N1 |
| InChI | InChI=1S/C5H12N2O2.C5H7NO3/c6-3-1-2-4(7)5(8)9;7-4-2-1-3(6-4)5(8)9/h4H,1-3,6-7H2,(H,8,9);3H,1-2H2,(H,6,7)(H,8,9)/t4-;3-/m00/s1 |
| InChIKey | TYQDOIOMUGXJOC-WOYAITHZSA-N |
| XLogP | -1.51 |
| TPSA | 155.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-2,5-diaminopentanoic acid;(2S)-5-oxopyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2,5-diaminopentanoic acid;(2S)-5-oxopyrrolidine-2-carboxylic acid?
The IUPAC name of (2S)-2,5-diaminopentanoic acid;(2S)-5-oxopyrrolidine-2-carboxylic acid (CID 6451930) is (2S)-2,5-diaminopentanoic acid;(2S)-5-oxopyrrolidine-2-carboxylic acid.
What is the SMILES notation for (2S)-2,5-diaminopentanoic acid;(2S)-5-oxopyrrolidine-2-carboxylic acid?
The canonical SMILES for (2S)-2,5-diaminopentanoic acid;(2S)-5-oxopyrrolidine-2-carboxylic acid is NCCC[C@H](N)C(=O)O.O=C1CC[C@@H](C(=O)O)N1.
What is the InChIKey of (2S)-2,5-diaminopentanoic acid;(2S)-5-oxopyrrolidine-2-carboxylic acid?
The InChIKey is TYQDOIOMUGXJOC-WOYAITHZSA-N. The full InChI is InChI=1S/C5H12N2O2.C5H7NO3/c6-3-1-2-4(7)5(8)9;7-4-2-1-3(6-4)5(8)9/h4H,1-3,6-7H2,(H,8,9);3H,1-2H2,(H,6,7)(H,8,9)/t4-;3-/m00/s1.
What are the key properties of (2S)-2,5-diaminopentanoic acid;(2S)-5-oxopyrrolidine-2-carboxylic acid?
(2S)-2,5-diaminopentanoic acid;(2S)-5-oxopyrrolidine-2-carboxylic acid has a molecular weight of 261.28 g/mol, XLogP of -1.51, 5 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,5-diaminopentanoic acid;(2S)-5-oxopyrrolidine-2-carboxylic acid is sourced from PubChem (CID 6451930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).