About N-[3-(1H-1,2,4-triazol-5-yl)propyl]oxolane-2-carboxamide
N-[3-(1H-1,2,4-triazol-5-yl)propyl]oxolane-2-carboxamide (PubChem CID 64519538) has the molecular formula C10H16N4O2
and a molecular weight of 224.26 g/mol. Its IUPAC name is N-[3-(1H-1,2,4-triazol-5-yl)propyl]oxolane-2-carboxamide.
Molecular Properties
| Compound Name | N-[3-(1H-1,2,4-triazol-5-yl)propyl]oxolane-2-carboxamide |
| PubChem CID | 64519538 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | N-[3-(1H-1,2,4-triazol-5-yl)propyl]oxolane-2-carboxamide |
| SMILES | O=C(NCCCc1ncn[nH]1)C1CCCO1 |
| InChI | InChI=1S/C10H16N4O2/c15-10(8-3-2-6-16-8)11-5-1-4-9-12-7-13-14-9/h7-8H,1-6H2,(H,11,15)(H,12,13,14) |
| InChIKey | CZHBTZBOUPBXHS-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(1H-1,2,4-triazol-5-yl)propyl]oxolane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(1H-1,2,4-triazol-5-yl)propyl]oxolane-2-carboxamide?
The IUPAC name of N-[3-(1H-1,2,4-triazol-5-yl)propyl]oxolane-2-carboxamide (CID 64519538) is N-[3-(1H-1,2,4-triazol-5-yl)propyl]oxolane-2-carboxamide.
What is the SMILES notation for N-[3-(1H-1,2,4-triazol-5-yl)propyl]oxolane-2-carboxamide?
The canonical SMILES for N-[3-(1H-1,2,4-triazol-5-yl)propyl]oxolane-2-carboxamide is O=C(NCCCc1ncn[nH]1)C1CCCO1.
What is the InChIKey of N-[3-(1H-1,2,4-triazol-5-yl)propyl]oxolane-2-carboxamide?
The InChIKey is CZHBTZBOUPBXHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4O2/c15-10(8-3-2-6-16-8)11-5-1-4-9-12-7-13-14-9/h7-8H,1-6H2,(H,11,15)(H,12,13,14).
What are the key properties of N-[3-(1H-1,2,4-triazol-5-yl)propyl]oxolane-2-carboxamide?
N-[3-(1H-1,2,4-triazol-5-yl)propyl]oxolane-2-carboxamide has a molecular weight of 224.26 g/mol, XLogP of 0.03, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(1H-1,2,4-triazol-5-yl)propyl]oxolane-2-carboxamide is sourced from PubChem (CID 64519538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).