C12HCl7O4 — CID 6452103
2,5-dichloro-3-hydroxy-6-(2,3,4,5,6-pentachlorophenoxy)cyclohexa-2,5-diene-1,4-dione (PubChem CID 6452103) has the molecular formula C12HCl7O4 and a molecular weight of 457.31 g/mol. Its IUPAC name is 2,5-dichloro-3-hydroxy-6-(2,3,4,5,6-pentachlorophenoxy)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-dichloro-3-hydroxy-6-(2,3,4,5,6-pentachlorophenoxy)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 6452103 |
| Molecular Formula | C12HCl7O4 |
| Molecular Weight | 457.31 g/mol |
| Exact Mass | 453.77 |
| IUPAC Name | 2,5-dichloro-3-hydroxy-6-(2,3,4,5,6-pentachlorophenoxy)cyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C(O)=C(Cl)C(=O)C(Oc2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)=C1Cl |
| InChI | InChI=1S/C12HCl7O4/c13-1-2(14)4(16)11(5(17)3(1)15)23-12-7(19)9(21)8(20)6(18)10(12)22/h20H |
| InChIKey | ZVTBWKWCYKHASC-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.31 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|