About N'-cyclopropyl-N'-(cyclopropylmethyl)-2-methyl-2-phenylpropane-1,3-diamine
N'-cyclopropyl-N'-(cyclopropylmethyl)-2-methyl-2-phenylpropane-1,3-diamine (PubChem CID 64522840) has the molecular formula C17H26N2
and a molecular weight of 258.41 g/mol. Its IUPAC name is N'-cyclopropyl-N'-(cyclopropylmethyl)-2-methyl-2-phenylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N'-cyclopropyl-N'-(cyclopropylmethyl)-2-methyl-2-phenylpropane-1,3-diamine |
| PubChem CID | 64522840 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | N'-cyclopropyl-N'-(cyclopropylmethyl)-2-methyl-2-phenylpropane-1,3-diamine |
| SMILES | CC(CN)(CN(CC1CC1)C1CC1)c1ccccc1 |
| InChI | InChI=1S/C17H26N2/c1-17(12-18,15-5-3-2-4-6-15)13-19(16-9-10-16)11-14-7-8-14/h2-6,14,16H,7-13,18H2,1H3 |
| InChIKey | BLDFEMSILDQDIE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N'-cyclopropyl-N'-(cyclopropylmethyl)-2-methyl-2-phenylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyclopropyl-N'-(cyclopropylmethyl)-2-methyl-2-phenylpropane-1,3-diamine?
The IUPAC name of N'-cyclopropyl-N'-(cyclopropylmethyl)-2-methyl-2-phenylpropane-1,3-diamine (CID 64522840) is N'-cyclopropyl-N'-(cyclopropylmethyl)-2-methyl-2-phenylpropane-1,3-diamine.
What is the SMILES notation for N'-cyclopropyl-N'-(cyclopropylmethyl)-2-methyl-2-phenylpropane-1,3-diamine?
The canonical SMILES for N'-cyclopropyl-N'-(cyclopropylmethyl)-2-methyl-2-phenylpropane-1,3-diamine is CC(CN)(CN(CC1CC1)C1CC1)c1ccccc1.
What is the InChIKey of N'-cyclopropyl-N'-(cyclopropylmethyl)-2-methyl-2-phenylpropane-1,3-diamine?
The InChIKey is BLDFEMSILDQDIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2/c1-17(12-18,15-5-3-2-4-6-15)13-19(16-9-10-16)11-14-7-8-14/h2-6,14,16H,7-13,18H2,1H3.
What are the key properties of N'-cyclopropyl-N'-(cyclopropylmethyl)-2-methyl-2-phenylpropane-1,3-diamine?
N'-cyclopropyl-N'-(cyclopropylmethyl)-2-methyl-2-phenylpropane-1,3-diamine has a molecular weight of 258.41 g/mol, XLogP of 2.78, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyclopropyl-N'-(cyclopropylmethyl)-2-methyl-2-phenylpropane-1,3-diamine is sourced from PubChem (CID 64522840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).