C11H17F3N4O2 — CID 64523289
3-amino-N-(3-ethoxypropyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-carboxamide (PubChem CID 64523289) has the molecular formula C11H17F3N4O2 and a molecular weight of 294.28 g/mol. Its IUPAC name is 3-amino-N-(3-ethoxypropyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 3-amino-N-(3-ethoxypropyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 64523289 |
| Molecular Formula | C11H17F3N4O2 |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 3-amino-N-(3-ethoxypropyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-carboxamide |
| SMILES | CCOCCCN(CC(F)(F)F)C(=O)c1cc(N)n[nH]1 |
| InChI | InChI=1S/C11H17F3N4O2/c1-2-20-5-3-4-18(7-11(12,13)14)10(19)8-6-9(15)17-16-8/h6H,2-5,7H2,1H3,(H3,15,16,17) |
| InChIKey | QZDWWZRUJNNLOT-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|