C11H19N5O3S — CID 64523295
(3-amino-1H-pyrazol-5-yl)-(4-propylsulfonylpiperazin-1-yl)methanone (PubChem CID 64523295) has the molecular formula C11H19N5O3S and a molecular weight of 301.37 g/mol. Its IUPAC name is (3-amino-1H-pyrazol-5-yl)-(4-propylsulfonylpiperazin-1-yl)methanone.
| Compound Name | (3-amino-1H-pyrazol-5-yl)-(4-propylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 64523295 |
| Molecular Formula | C11H19N5O3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | (3-amino-1H-pyrazol-5-yl)-(4-propylsulfonylpiperazin-1-yl)methanone |
| SMILES | CCCS(=O)(=O)N1CCN(C(=O)c2cc(N)n[nH]2)CC1 |
| InChI | InChI=1S/C11H19N5O3S/c1-2-7-20(18,19)16-5-3-15(4-6-16)11(17)9-8-10(12)14-13-9/h8H,2-7H2,1H3,(H3,12,13,14) |
| InChIKey | OIXGCQKGMSEROF-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |