C13H23N7O3 — CID 6452400
formaldehyde;N-(2-methyl-4-oxopentan-2-yl)prop-2-enamide;1,3,5-triazine-2,4,6-triamine (PubChem CID 6452400) has the molecular formula C13H23N7O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is formaldehyde;N-(2-methyl-4-oxopentan-2-yl)prop-2-enamide;1,3,5-triazine-2,4,6-triamine.
| Compound Name | formaldehyde;N-(2-methyl-4-oxopentan-2-yl)prop-2-enamide;1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 6452400 |
| Molecular Formula | C13H23N7O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | formaldehyde;N-(2-methyl-4-oxopentan-2-yl)prop-2-enamide;1,3,5-triazine-2,4,6-triamine |
| SMILES | C=CC(=O)NC(C)(C)CC(C)=O.C=O.Nc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C9H15NO2.C3H6N6.CH2O/c1-5-8(12)10-9(3,4)6-7(2)11;4-1-7-2(5)9-3(6)8-1;1-2/h5H,1,6H2,2-4H3,(H,10,12);(H6,4,5,6,7,8,9);1H2 |
| InChIKey | YKTJPTWRSCIJHT-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 179.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|