About 3-amino-N-(5-methyl-1,3-thiazol-2-yl)-1H-pyrazole-5-carboxamide
3-amino-N-(5-methyl-1,3-thiazol-2-yl)-1H-pyrazole-5-carboxamide (PubChem CID 64524009) has the molecular formula C8H9N5OS
and a molecular weight of 223.26 g/mol. Its IUPAC name is 3-amino-N-(5-methyl-1,3-thiazol-2-yl)-1H-pyrazole-5-carboxamide.
Molecular Properties
| Compound Name | 3-amino-N-(5-methyl-1,3-thiazol-2-yl)-1H-pyrazole-5-carboxamide |
| PubChem CID | 64524009 |
| Molecular Formula | C8H9N5OS |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 3-amino-N-(5-methyl-1,3-thiazol-2-yl)-1H-pyrazole-5-carboxamide |
| SMILES | Cc1cnc(NC(=O)c2cc(N)n[nH]2)s1 |
| InChI | InChI=1S/C8H9N5OS/c1-4-3-10-8(15-4)11-7(14)5-2-6(9)13-12-5/h2-3H,1H3,(H3,9,12,13)(H,10,11,14) |
| InChIKey | SSJKKLUIJZAPLM-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-N-(5-methyl-1,3-thiazol-2-yl)-1H-pyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-(5-methyl-1,3-thiazol-2-yl)-1H-pyrazole-5-carboxamide?
The IUPAC name of 3-amino-N-(5-methyl-1,3-thiazol-2-yl)-1H-pyrazole-5-carboxamide (CID 64524009) is 3-amino-N-(5-methyl-1,3-thiazol-2-yl)-1H-pyrazole-5-carboxamide.
What is the SMILES notation for 3-amino-N-(5-methyl-1,3-thiazol-2-yl)-1H-pyrazole-5-carboxamide?
The canonical SMILES for 3-amino-N-(5-methyl-1,3-thiazol-2-yl)-1H-pyrazole-5-carboxamide is Cc1cnc(NC(=O)c2cc(N)n[nH]2)s1.
What is the InChIKey of 3-amino-N-(5-methyl-1,3-thiazol-2-yl)-1H-pyrazole-5-carboxamide?
The InChIKey is SSJKKLUIJZAPLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N5OS/c1-4-3-10-8(15-4)11-7(14)5-2-6(9)13-12-5/h2-3H,1H3,(H3,9,12,13)(H,10,11,14).
What are the key properties of 3-amino-N-(5-methyl-1,3-thiazol-2-yl)-1H-pyrazole-5-carboxamide?
3-amino-N-(5-methyl-1,3-thiazol-2-yl)-1H-pyrazole-5-carboxamide has a molecular weight of 223.26 g/mol, XLogP of 1.01, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-(5-methyl-1,3-thiazol-2-yl)-1H-pyrazole-5-carboxamide is sourced from PubChem (CID 64524009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).