C13H15ClN4O2 — CID 64524072
3-amino-N-[2-(2-chlorophenoxy)ethyl]-N-methyl-1H-pyrazole-5-carboxamide (PubChem CID 64524072) has the molecular formula C13H15ClN4O2 and a molecular weight of 294.74 g/mol. Its IUPAC name is 3-amino-N-[2-(2-chlorophenoxy)ethyl]-N-methyl-1H-pyrazole-5-carboxamide.
| Compound Name | 3-amino-N-[2-(2-chlorophenoxy)ethyl]-N-methyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 64524072 |
| Molecular Formula | C13H15ClN4O2 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 3-amino-N-[2-(2-chlorophenoxy)ethyl]-N-methyl-1H-pyrazole-5-carboxamide |
| SMILES | CN(CCOc1ccccc1Cl)C(=O)c1cc(N)n[nH]1 |
| InChI | InChI=1S/C13H15ClN4O2/c1-18(13(19)10-8-12(15)17-16-10)6-7-20-11-5-3-2-4-9(11)14/h2-5,8H,6-7H2,1H3,(H3,15,16,17) |
| InChIKey | FBJVKVMVMAEMHX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |