About 3-amino-N-(3,3,3-trifluoropropyl)-1H-pyrazole-5-carboxamide
3-amino-N-(3,3,3-trifluoropropyl)-1H-pyrazole-5-carboxamide (PubChem CID 64524468) has the molecular formula C7H9F3N4O
and a molecular weight of 222.17 g/mol. Its IUPAC name is 3-amino-N-(3,3,3-trifluoropropyl)-1H-pyrazole-5-carboxamide.
Molecular Properties
| Compound Name | 3-amino-N-(3,3,3-trifluoropropyl)-1H-pyrazole-5-carboxamide |
| PubChem CID | 64524468 |
| Molecular Formula | C7H9F3N4O |
| Molecular Weight | 222.17 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 3-amino-N-(3,3,3-trifluoropropyl)-1H-pyrazole-5-carboxamide |
| SMILES | Nc1cc(C(=O)NCCC(F)(F)F)[nH]n1 |
| InChI | InChI=1S/C7H9F3N4O/c8-7(9,10)1-2-12-6(15)4-3-5(11)14-13-4/h3H,1-2H2,(H,12,15)(H3,11,13,14) |
| InChIKey | LKMYUDDAUVYUMC-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.17 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-N-(3,3,3-trifluoropropyl)-1H-pyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-(3,3,3-trifluoropropyl)-1H-pyrazole-5-carboxamide?
The IUPAC name of 3-amino-N-(3,3,3-trifluoropropyl)-1H-pyrazole-5-carboxamide (CID 64524468) is 3-amino-N-(3,3,3-trifluoropropyl)-1H-pyrazole-5-carboxamide.
What is the SMILES notation for 3-amino-N-(3,3,3-trifluoropropyl)-1H-pyrazole-5-carboxamide?
The canonical SMILES for 3-amino-N-(3,3,3-trifluoropropyl)-1H-pyrazole-5-carboxamide is Nc1cc(C(=O)NCCC(F)(F)F)[nH]n1.
What is the InChIKey of 3-amino-N-(3,3,3-trifluoropropyl)-1H-pyrazole-5-carboxamide?
The InChIKey is LKMYUDDAUVYUMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F3N4O/c8-7(9,10)1-2-12-6(15)4-3-5(11)14-13-4/h3H,1-2H2,(H,12,15)(H3,11,13,14).
What are the key properties of 3-amino-N-(3,3,3-trifluoropropyl)-1H-pyrazole-5-carboxamide?
3-amino-N-(3,3,3-trifluoropropyl)-1H-pyrazole-5-carboxamide has a molecular weight of 222.17 g/mol, XLogP of 0.67, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-(3,3,3-trifluoropropyl)-1H-pyrazole-5-carboxamide is sourced from PubChem (CID 64524468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).