C10H17N5O — CID 64524814
3-amino-N-(1-methylpiperidin-4-yl)-1H-pyrazole-5-carboxamide (PubChem CID 64524814) has the molecular formula C10H17N5O and a molecular weight of 223.28 g/mol. Its IUPAC name is 3-amino-N-(1-methylpiperidin-4-yl)-1H-pyrazole-5-carboxamide.
| Compound Name | 3-amino-N-(1-methylpiperidin-4-yl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 64524814 |
| Molecular Formula | C10H17N5O |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 3-amino-N-(1-methylpiperidin-4-yl)-1H-pyrazole-5-carboxamide |
| SMILES | CN1CCC(NC(=O)c2cc(N)n[nH]2)CC1 |
| InChI | InChI=1S/C10H17N5O/c1-15-4-2-7(3-5-15)12-10(16)8-6-9(11)14-13-8/h6-7H,2-5H2,1H3,(H,12,16)(H3,11,13,14) |
| InChIKey | QXUQBIUVSKRUBY-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |