C11H11FN4O2 — CID 64525066
3-amino-N-(4-fluoro-2-methoxyphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 64525066) has the molecular formula C11H11FN4O2 and a molecular weight of 250.23 g/mol. Its IUPAC name is 3-amino-N-(4-fluoro-2-methoxyphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 3-amino-N-(4-fluoro-2-methoxyphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 64525066 |
| Molecular Formula | C11H11FN4O2 |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 3-amino-N-(4-fluoro-2-methoxyphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | COc1cc(F)ccc1NC(=O)c1cc(N)n[nH]1 |
| InChI | InChI=1S/C11H11FN4O2/c1-18-9-4-6(12)2-3-7(9)14-11(17)8-5-10(13)16-15-8/h2-5H,1H3,(H,14,17)(H3,13,15,16) |
| InChIKey | MWWZTYKXWPIYJC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |