About 4-methylbenzenesulfonate;trimethyl(phenyl)azanium
4-methylbenzenesulfonate;trimethyl(phenyl)azanium (PubChem CID 6452533) has the molecular formula C16H21NO3S
and a molecular weight of 307.42 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;trimethyl(phenyl)azanium.
Molecular Properties
| Compound Name | 4-methylbenzenesulfonate;trimethyl(phenyl)azanium |
| PubChem CID | 6452533 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 4-methylbenzenesulfonate;trimethyl(phenyl)azanium |
| SMILES | C[N+](C)(C)c1ccccc1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C9H14N.C7H8O3S/c1-10(2,3)9-7-5-4-6-8-9;1-6-2-4-7(5-3-6)11(8,9)10/h4-8H,1-3H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | LNYAMYWNIGXAOL-UHFFFAOYSA-M |
| XLogP | 2.78 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methylbenzenesulfonate;trimethyl(phenyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzenesulfonate;trimethyl(phenyl)azanium?
The IUPAC name of 4-methylbenzenesulfonate;trimethyl(phenyl)azanium (CID 6452533) is 4-methylbenzenesulfonate;trimethyl(phenyl)azanium.
What is the SMILES notation for 4-methylbenzenesulfonate;trimethyl(phenyl)azanium?
The canonical SMILES for 4-methylbenzenesulfonate;trimethyl(phenyl)azanium is C[N+](C)(C)c1ccccc1.Cc1ccc(S(=O)(=O)[O-])cc1.
What is the InChIKey of 4-methylbenzenesulfonate;trimethyl(phenyl)azanium?
The InChIKey is LNYAMYWNIGXAOL-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H14N.C7H8O3S/c1-10(2,3)9-7-5-4-6-8-9;1-6-2-4-7(5-3-6)11(8,9)10/h4-8H,1-3H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1.
What are the key properties of 4-methylbenzenesulfonate;trimethyl(phenyl)azanium?
4-methylbenzenesulfonate;trimethyl(phenyl)azanium has a molecular weight of 307.42 g/mol, XLogP of 2.78, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzenesulfonate;trimethyl(phenyl)azanium is sourced from PubChem (CID 6452533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).