About formaldehyde;2-(2-hydroxyphenyl)sulfonylphenol
formaldehyde;2-(2-hydroxyphenyl)sulfonylphenol (PubChem CID 6452549) has the molecular formula C13H12O5S
and a molecular weight of 280.30 g/mol. Its IUPAC name is formaldehyde;2-(2-hydroxyphenyl)sulfonylphenol.
Molecular Properties
| Compound Name | formaldehyde;2-(2-hydroxyphenyl)sulfonylphenol |
| PubChem CID | 6452549 |
| Molecular Formula | C13H12O5S |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | formaldehyde;2-(2-hydroxyphenyl)sulfonylphenol |
| SMILES | C=O.O=S(=O)(c1ccccc1O)c1ccccc1O |
| InChI | InChI=1S/C12H10O4S.CH2O/c13-9-5-1-3-7-11(9)17(15,16)12-8-4-2-6-10(12)14;1-2/h1-8,13-14H;1H2 |
| InChIKey | IMLMEIUTKRNUPD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze formaldehyde;2-(2-hydroxyphenyl)sulfonylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;2-(2-hydroxyphenyl)sulfonylphenol?
The IUPAC name of formaldehyde;2-(2-hydroxyphenyl)sulfonylphenol (CID 6452549) is formaldehyde;2-(2-hydroxyphenyl)sulfonylphenol.
What is the SMILES notation for formaldehyde;2-(2-hydroxyphenyl)sulfonylphenol?
The canonical SMILES for formaldehyde;2-(2-hydroxyphenyl)sulfonylphenol is C=O.O=S(=O)(c1ccccc1O)c1ccccc1O.
What is the InChIKey of formaldehyde;2-(2-hydroxyphenyl)sulfonylphenol?
The InChIKey is IMLMEIUTKRNUPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O4S.CH2O/c13-9-5-1-3-7-11(9)17(15,16)12-8-4-2-6-10(12)14;1-2/h1-8,13-14H;1H2.
What are the key properties of formaldehyde;2-(2-hydroxyphenyl)sulfonylphenol?
formaldehyde;2-(2-hydroxyphenyl)sulfonylphenol has a molecular weight of 280.30 g/mol, XLogP of 1.75, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;2-(2-hydroxyphenyl)sulfonylphenol is sourced from PubChem (CID 6452549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).