About 7H-indeno[4,5-h]isoquinoline
7H-indeno[4,5-h]isoquinoline (PubChem CID 6452601) has the molecular formula C16H11N
and a molecular weight of 217.27 g/mol. Its IUPAC name is 7H-indeno[4,5-h]isoquinoline.
Molecular Properties
| Compound Name | 7H-indeno[4,5-h]isoquinoline |
| PubChem CID | 6452601 |
| Molecular Formula | C16H11N |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 7H-indeno[4,5-h]isoquinoline |
| SMILES | C1=Cc2c(ccc3c4c(ccc23)=CCN=C4)=C1 |
| InChI | InChI=1S/C16H11N/c1-2-11-4-7-15-14(13(11)3-1)6-5-12-8-9-17-10-16(12)15/h1-8,10H,9H2 |
| InChIKey | JHCGFTKIMCQMHR-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7H-indeno[4,5-h]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-indeno[4,5-h]isoquinoline?
The IUPAC name of 7H-indeno[4,5-h]isoquinoline (CID 6452601) is 7H-indeno[4,5-h]isoquinoline.
What is the SMILES notation for 7H-indeno[4,5-h]isoquinoline?
The canonical SMILES for 7H-indeno[4,5-h]isoquinoline is C1=Cc2c(ccc3c4c(ccc23)=CCN=C4)=C1.
What is the InChIKey of 7H-indeno[4,5-h]isoquinoline?
The InChIKey is JHCGFTKIMCQMHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11N/c1-2-11-4-7-15-14(13(11)3-1)6-5-12-8-9-17-10-16(12)15/h1-8,10H,9H2.
What are the key properties of 7H-indeno[4,5-h]isoquinoline?
7H-indeno[4,5-h]isoquinoline has a molecular weight of 217.27 g/mol, XLogP of 1.86, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-indeno[4,5-h]isoquinoline is sourced from PubChem (CID 6452601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).