About 3-[(1,1-dioxothian-4-yl)sulfonylamino]-1H-pyrazole-5-carboxylic acid
3-[(1,1-dioxothian-4-yl)sulfonylamino]-1H-pyrazole-5-carboxylic acid (PubChem CID 64526722) has the molecular formula C9H13N3O6S2
and a molecular weight of 323.35 g/mol. Its IUPAC name is 3-[(1,1-dioxothian-4-yl)sulfonylamino]-1H-pyrazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 3-[(1,1-dioxothian-4-yl)sulfonylamino]-1H-pyrazole-5-carboxylic acid |
| PubChem CID | 64526722 |
| Molecular Formula | C9H13N3O6S2 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 3-[(1,1-dioxothian-4-yl)sulfonylamino]-1H-pyrazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(NS(=O)(=O)C2CCS(=O)(=O)CC2)n[nH]1 |
| InChI | InChI=1S/C9H13N3O6S2/c13-9(14)7-5-8(11-10-7)12-20(17,18)6-1-3-19(15,16)4-2-6/h5-6H,1-4H2,(H,13,14)(H2,10,11,12) |
| InChIKey | LJQPDJFPSPFPRH-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 146.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(1,1-dioxothian-4-yl)sulfonylamino]-1H-pyrazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1,1-dioxothian-4-yl)sulfonylamino]-1H-pyrazole-5-carboxylic acid?
The IUPAC name of 3-[(1,1-dioxothian-4-yl)sulfonylamino]-1H-pyrazole-5-carboxylic acid (CID 64526722) is 3-[(1,1-dioxothian-4-yl)sulfonylamino]-1H-pyrazole-5-carboxylic acid.
What is the SMILES notation for 3-[(1,1-dioxothian-4-yl)sulfonylamino]-1H-pyrazole-5-carboxylic acid?
The canonical SMILES for 3-[(1,1-dioxothian-4-yl)sulfonylamino]-1H-pyrazole-5-carboxylic acid is O=C(O)c1cc(NS(=O)(=O)C2CCS(=O)(=O)CC2)n[nH]1.
What is the InChIKey of 3-[(1,1-dioxothian-4-yl)sulfonylamino]-1H-pyrazole-5-carboxylic acid?
The InChIKey is LJQPDJFPSPFPRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O6S2/c13-9(14)7-5-8(11-10-7)12-20(17,18)6-1-3-19(15,16)4-2-6/h5-6H,1-4H2,(H,13,14)(H2,10,11,12).
What are the key properties of 3-[(1,1-dioxothian-4-yl)sulfonylamino]-1H-pyrazole-5-carboxylic acid?
3-[(1,1-dioxothian-4-yl)sulfonylamino]-1H-pyrazole-5-carboxylic acid has a molecular weight of 323.35 g/mol, XLogP of -0.57, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1,1-dioxothian-4-yl)sulfonylamino]-1H-pyrazole-5-carboxylic acid is sourced from PubChem (CID 64526722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).