C12H12ClN5O3 — CID 64527054
3-[(5-chloro-2-propan-2-ylpyrimidine-4-carbonyl)amino]-1H-pyrazole-5-carboxylic acid (PubChem CID 64527054) has the molecular formula C12H12ClN5O3 and a molecular weight of 309.71 g/mol. Its IUPAC name is 3-[(5-chloro-2-propan-2-ylpyrimidine-4-carbonyl)amino]-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-[(5-chloro-2-propan-2-ylpyrimidine-4-carbonyl)amino]-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 64527054 |
| Molecular Formula | C12H12ClN5O3 |
| Molecular Weight | 309.71 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 3-[(5-chloro-2-propan-2-ylpyrimidine-4-carbonyl)amino]-1H-pyrazole-5-carboxylic acid |
| SMILES | CC(C)c1ncc(Cl)c(C(=O)Nc2cc(C(=O)O)[nH]n2)n1 |
| InChI | InChI=1S/C12H12ClN5O3/c1-5(2)10-14-4-6(13)9(16-10)11(19)15-8-3-7(12(20)21)17-18-8/h3-5H,1-2H3,(H,20,21)(H2,15,17,18,19) |
| InChIKey | MLOIFGIPIXPSCL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.71 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |