About N'-(2-aminoethyl)ethane-1,2-diamine;formaldehyde;2-nonylphenol
N'-(2-aminoethyl)ethane-1,2-diamine;formaldehyde;2-nonylphenol (PubChem CID 6452810) has the molecular formula C20H39N3O2
and a molecular weight of 353.55 g/mol. Its IUPAC name is N'-(2-aminoethyl)ethane-1,2-diamine;formaldehyde;2-nonylphenol.
Molecular Properties
| Compound Name | N'-(2-aminoethyl)ethane-1,2-diamine;formaldehyde;2-nonylphenol |
| PubChem CID | 6452810 |
| Molecular Formula | C20H39N3O2 |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.30 |
| IUPAC Name | N'-(2-aminoethyl)ethane-1,2-diamine;formaldehyde;2-nonylphenol |
| SMILES | C=O.CCCCCCCCCc1ccccc1O.NCCNCCN |
| InChI | InChI=1S/C15H24O.C4H13N3.CH2O/c1-2-3-4-5-6-7-8-11-14-12-9-10-13-15(14)16;5-1-3-7-4-2-6;1-2/h9-10,12-13,16H,2-8,11H2,1H3;7H,1-6H2;1H2 |
| InChIKey | OTEJSQUIIRFGBU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-aminoethyl)ethane-1,2-diamine;formaldehyde;2-nonylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-aminoethyl)ethane-1,2-diamine;formaldehyde;2-nonylphenol?
The IUPAC name of N'-(2-aminoethyl)ethane-1,2-diamine;formaldehyde;2-nonylphenol (CID 6452810) is N'-(2-aminoethyl)ethane-1,2-diamine;formaldehyde;2-nonylphenol.
What is the SMILES notation for N'-(2-aminoethyl)ethane-1,2-diamine;formaldehyde;2-nonylphenol?
The canonical SMILES for N'-(2-aminoethyl)ethane-1,2-diamine;formaldehyde;2-nonylphenol is C=O.CCCCCCCCCc1ccccc1O.NCCNCCN.
What is the InChIKey of N'-(2-aminoethyl)ethane-1,2-diamine;formaldehyde;2-nonylphenol?
The InChIKey is OTEJSQUIIRFGBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O.C4H13N3.CH2O/c1-2-3-4-5-6-7-8-11-14-12-9-10-13-15(14)16;5-1-3-7-4-2-6;1-2/h9-10,12-13,16H,2-8,11H2,1H3;7H,1-6H2;1H2.
What are the key properties of N'-(2-aminoethyl)ethane-1,2-diamine;formaldehyde;2-nonylphenol?
N'-(2-aminoethyl)ethane-1,2-diamine;formaldehyde;2-nonylphenol has a molecular weight of 353.55 g/mol, XLogP of 2.99, 12 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-aminoethyl)ethane-1,2-diamine;formaldehyde;2-nonylphenol is sourced from PubChem (CID 6452810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).