About 2-ethylhexane-1,3-diol;hexanedioic acid
2-ethylhexane-1,3-diol;hexanedioic acid (PubChem CID 6452813) has the molecular formula C14H28O6
and a molecular weight of 292.37 g/mol. Its IUPAC name is 2-ethylhexane-1,3-diol;hexanedioic acid.
Molecular Properties
| Compound Name | 2-ethylhexane-1,3-diol;hexanedioic acid |
| PubChem CID | 6452813 |
| Molecular Formula | C14H28O6 |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 2-ethylhexane-1,3-diol;hexanedioic acid |
| SMILES | CCCC(O)C(CC)CO.O=C(O)CCCCC(=O)O |
| InChI | InChI=1S/C8H18O2.C6H10O4/c1-3-5-8(10)7(4-2)6-9;7-5(8)3-1-2-4-6(9)10/h7-10H,3-6H2,1-2H3;1-4H2,(H,7,8)(H,9,10) |
| InChIKey | WZDSCYYAQLVXCP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhexane-1,3-diol;hexanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexane-1,3-diol;hexanedioic acid?
The IUPAC name of 2-ethylhexane-1,3-diol;hexanedioic acid (CID 6452813) is 2-ethylhexane-1,3-diol;hexanedioic acid.
What is the SMILES notation for 2-ethylhexane-1,3-diol;hexanedioic acid?
The canonical SMILES for 2-ethylhexane-1,3-diol;hexanedioic acid is CCCC(O)C(CC)CO.O=C(O)CCCCC(=O)O.
What is the InChIKey of 2-ethylhexane-1,3-diol;hexanedioic acid?
The InChIKey is WZDSCYYAQLVXCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O2.C6H10O4/c1-3-5-8(10)7(4-2)6-9;7-5(8)3-1-2-4-6(9)10/h7-10H,3-6H2,1-2H3;1-4H2,(H,7,8)(H,9,10).
What are the key properties of 2-ethylhexane-1,3-diol;hexanedioic acid?
2-ethylhexane-1,3-diol;hexanedioic acid has a molecular weight of 292.37 g/mol, XLogP of 1.88, 10 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexane-1,3-diol;hexanedioic acid is sourced from PubChem (CID 6452813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).