C15H29NO4 — CID 64528974
ethyl 5-methoxy-3,5-dimethyl-3-morpholin-4-ylhexanoate (PubChem CID 64528974) has the molecular formula C15H29NO4 and a molecular weight of 287.40 g/mol. Its IUPAC name is ethyl 5-methoxy-3,5-dimethyl-3-morpholin-4-ylhexanoate.
| Compound Name | ethyl 5-methoxy-3,5-dimethyl-3-morpholin-4-ylhexanoate |
|---|---|
| PubChem CID | 64528974 |
| Molecular Formula | C15H29NO4 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | ethyl 5-methoxy-3,5-dimethyl-3-morpholin-4-ylhexanoate |
| SMILES | CCOC(=O)CC(C)(CC(C)(C)OC)N1CCOCC1 |
| InChI | InChI=1S/C15H29NO4/c1-6-20-13(17)11-15(4,12-14(2,3)18-5)16-7-9-19-10-8-16/h6-12H2,1-5H3 |
| InChIKey | PLVVMPAWRLKTIN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |