About 4-(3,4-dichlorophenyl)phenol
4-(3,4-dichlorophenyl)phenol (PubChem CID 6452909) has the molecular formula C12H8Cl2O
and a molecular weight of 239.10 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)phenol.
Molecular Properties
| Compound Name | 4-(3,4-dichlorophenyl)phenol |
| PubChem CID | 6452909 |
| Molecular Formula | C12H8Cl2O |
| Molecular Weight | 239.10 g/mol |
| Exact Mass | 238.00 |
| IUPAC Name | 4-(3,4-dichlorophenyl)phenol |
| SMILES | Oc1ccc(-c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C12H8Cl2O/c13-11-6-3-9(7-12(11)14)8-1-4-10(15)5-2-8/h1-7,15H |
| InChIKey | UTTIPSVNOWSCRD-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.10 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(3,4-dichlorophenyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dichlorophenyl)phenol?
The IUPAC name of 4-(3,4-dichlorophenyl)phenol (CID 6452909) is 4-(3,4-dichlorophenyl)phenol.
What is the SMILES notation for 4-(3,4-dichlorophenyl)phenol?
The canonical SMILES for 4-(3,4-dichlorophenyl)phenol is Oc1ccc(-c2ccc(Cl)c(Cl)c2)cc1.
What is the InChIKey of 4-(3,4-dichlorophenyl)phenol?
The InChIKey is UTTIPSVNOWSCRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8Cl2O/c13-11-6-3-9(7-12(11)14)8-1-4-10(15)5-2-8/h1-7,15H.
What are the key properties of 4-(3,4-dichlorophenyl)phenol?
4-(3,4-dichlorophenyl)phenol has a molecular weight of 239.10 g/mol, XLogP of 4.37, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dichlorophenyl)phenol is sourced from PubChem (CID 6452909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).