About N-cyclohexyl-N-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]acetamide
N-cyclohexyl-N-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]acetamide (PubChem CID 645291) has the molecular formula C20H26N2O2
and a molecular weight of 326.44 g/mol. Its IUPAC name is N-cyclohexyl-N-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]acetamide.
Molecular Properties
| Compound Name | N-cyclohexyl-N-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]acetamide |
| PubChem CID | 645291 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | N-cyclohexyl-N-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]acetamide |
| SMILES | CC(=O)N(Cc1cc2c(C)cc(C)cc2[nH]c1=O)C1CCCCC1 |
| InChI | InChI=1S/C20H26N2O2/c1-13-9-14(2)18-11-16(20(24)21-19(18)10-13)12-22(15(3)23)17-7-5-4-6-8-17/h9-11,17H,4-8,12H2,1-3H3,(H,21,24) |
| InChIKey | CRRACWHCQBUBBT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-cyclohexyl-N-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-N-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]acetamide?
The IUPAC name of N-cyclohexyl-N-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]acetamide (CID 645291) is N-cyclohexyl-N-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]acetamide.
What is the SMILES notation for N-cyclohexyl-N-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]acetamide?
The canonical SMILES for N-cyclohexyl-N-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]acetamide is CC(=O)N(Cc1cc2c(C)cc(C)cc2[nH]c1=O)C1CCCCC1.
What is the InChIKey of N-cyclohexyl-N-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]acetamide?
The InChIKey is CRRACWHCQBUBBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N2O2/c1-13-9-14(2)18-11-16(20(24)21-19(18)10-13)12-22(15(3)23)17-7-5-4-6-8-17/h9-11,17H,4-8,12H2,1-3H3,(H,21,24).
What are the key properties of N-cyclohexyl-N-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]acetamide?
N-cyclohexyl-N-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]acetamide has a molecular weight of 326.44 g/mol, XLogP of 3.83, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-N-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]acetamide is sourced from PubChem (CID 645291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).