C11H12F3N5 — CID 64529648
N-[3-(1H-1,2,4-triazol-5-yl)propyl]-6-(trifluoromethyl)pyridin-2-amine (PubChem CID 64529648) has the molecular formula C11H12F3N5 and a molecular weight of 271.25 g/mol. Its IUPAC name is N-[3-(1H-1,2,4-triazol-5-yl)propyl]-6-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[3-(1H-1,2,4-triazol-5-yl)propyl]-6-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 64529648 |
| Molecular Formula | C11H12F3N5 |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | N-[3-(1H-1,2,4-triazol-5-yl)propyl]-6-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1cccc(NCCCc2ncn[nH]2)n1 |
| InChI | InChI=1S/C11H12F3N5/c12-11(13,14)8-3-1-4-9(18-8)15-6-2-5-10-16-7-17-19-10/h1,3-4,7H,2,5-6H2,(H,15,18)(H,16,17,19) |
| InChIKey | PTYMDDPRZFZXIF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|