C6H9F3N4O2S — CID 64529871
1,1,1-trifluoro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]methanesulfonamide (PubChem CID 64529871) has the molecular formula C6H9F3N4O2S and a molecular weight of 258.22 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]methanesulfonamide |
|---|---|
| PubChem CID | 64529871 |
| Molecular Formula | C6H9F3N4O2S |
| Molecular Weight | 258.22 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 1,1,1-trifluoro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]methanesulfonamide |
| SMILES | O=S(=O)(NCCCc1ncn[nH]1)C(F)(F)F |
| InChI | InChI=1S/C6H9F3N4O2S/c7-6(8,9)16(14,15)12-3-1-2-5-10-4-11-13-5/h4,12H,1-3H2,(H,10,11,13) |
| InChIKey | OTSXLLHHHODQNJ-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.22 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|