C11H19N5O2 — CID 64530345
4-methoxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyrrolidine-2-carboxamide (PubChem CID 64530345) has the molecular formula C11H19N5O2 and a molecular weight of 253.31 g/mol. Its IUPAC name is 4-methoxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyrrolidine-2-carboxamide.
| Compound Name | 4-methoxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 64530345 |
| Molecular Formula | C11H19N5O2 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 4-methoxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyrrolidine-2-carboxamide |
| SMILES | COC1CNC(C(=O)NCCCc2ncn[nH]2)C1 |
| InChI | InChI=1S/C11H19N5O2/c1-18-8-5-9(13-6-8)11(17)12-4-2-3-10-14-7-15-16-10/h7-9,13H,2-6H2,1H3,(H,12,17)(H,14,15,16) |
| InChIKey | PLWXOWBIOWYBLM-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|