C16H25N5 — CID 64530565
2,6,6-trimethyl-1-[3-(1H-1,2,4-triazol-5-yl)propyl]-5,7-dihydro-4H-indol-4-amine (PubChem CID 64530565) has the molecular formula C16H25N5 and a molecular weight of 287.41 g/mol. Its IUPAC name is 2,6,6-trimethyl-1-[3-(1H-1,2,4-triazol-5-yl)propyl]-5,7-dihydro-4H-indol-4-amine.
| Compound Name | 2,6,6-trimethyl-1-[3-(1H-1,2,4-triazol-5-yl)propyl]-5,7-dihydro-4H-indol-4-amine |
|---|---|
| PubChem CID | 64530565 |
| Molecular Formula | C16H25N5 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | 2,6,6-trimethyl-1-[3-(1H-1,2,4-triazol-5-yl)propyl]-5,7-dihydro-4H-indol-4-amine |
| SMILES | Cc1cc2c(n1CCCc1ncn[nH]1)CC(C)(C)CC2N |
| InChI | InChI=1S/C16H25N5/c1-11-7-12-13(17)8-16(2,3)9-14(12)21(11)6-4-5-15-18-10-19-20-15/h7,10,13H,4-6,8-9,17H2,1-3H3,(H,18,19,20) |
| InChIKey | PCZUPQHJLFADIA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |