C13H16N4O2S — CID 64531426
1,1-dioxo-N-[3-(1H-1,2,4-triazol-5-yl)propyl]-2,3-dihydro-1-benzothiophen-3-amine (PubChem CID 64531426) has the molecular formula C13H16N4O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is 1,1-dioxo-N-[3-(1H-1,2,4-triazol-5-yl)propyl]-2,3-dihydro-1-benzothiophen-3-amine.
| Compound Name | 1,1-dioxo-N-[3-(1H-1,2,4-triazol-5-yl)propyl]-2,3-dihydro-1-benzothiophen-3-amine |
|---|---|
| PubChem CID | 64531426 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 1,1-dioxo-N-[3-(1H-1,2,4-triazol-5-yl)propyl]-2,3-dihydro-1-benzothiophen-3-amine |
| SMILES | O=S1(=O)CC(NCCCc2ncn[nH]2)c2ccccc21 |
| InChI | InChI=1S/C13H16N4O2S/c18-20(19)8-11(10-4-1-2-5-12(10)20)14-7-3-6-13-15-9-16-17-13/h1-2,4-5,9,11,14H,3,6-8H2,(H,15,16,17) |
| InChIKey | JSXXCNFDUNIKFK-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|