C12H14N2O — CID 6453168
1,2,3,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-4-one (PubChem CID 6453168) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 1,2,3,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-4-one.
| Compound Name | 1,2,3,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-4-one |
|---|---|
| PubChem CID | 6453168 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 1,2,3,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-4-one |
| SMILES | O=C1CNCC2c3ccccc3CCN12 |
| InChI | InChI=1S/C12H14N2O/c15-12-8-13-7-11-10-4-2-1-3-9(10)5-6-14(11)12/h1-4,11,13H,5-8H2 |
| InChIKey | GTRDOUXISKJZGL-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |