About 4-amino-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]butanamide
4-amino-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]butanamide (PubChem CID 64531750) has the molecular formula C8H15N5O
and a molecular weight of 197.24 g/mol. Its IUPAC name is 4-amino-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]butanamide.
Molecular Properties
| Compound Name | 4-amino-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]butanamide |
| PubChem CID | 64531750 |
| Molecular Formula | C8H15N5O |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | 4-amino-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]butanamide |
| SMILES | NCCCC(=O)NCCc1ncn[nH]1 |
| InChI | InChI=1S/C8H15N5O/c9-4-1-2-8(14)10-5-3-7-11-6-12-13-7/h6H,1-5,9H2,(H,10,14)(H,11,12,13) |
| InChIKey | AFVKLICHPBCCCP-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-amino-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]butanamide?
The IUPAC name of 4-amino-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]butanamide (CID 64531750) is 4-amino-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]butanamide.
What is the SMILES notation for 4-amino-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]butanamide?
The canonical SMILES for 4-amino-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]butanamide is NCCCC(=O)NCCc1ncn[nH]1.
What is the InChIKey of 4-amino-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]butanamide?
The InChIKey is AFVKLICHPBCCCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N5O/c9-4-1-2-8(14)10-5-3-7-11-6-12-13-7/h6H,1-5,9H2,(H,10,14)(H,11,12,13).
What are the key properties of 4-amino-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]butanamide?
4-amino-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]butanamide has a molecular weight of 197.24 g/mol, XLogP of -0.80, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]butanamide is sourced from PubChem (CID 64531750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).