C6H10F2N4O2S — CID 64531869
1,1-difluoro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]methanesulfonamide (PubChem CID 64531869) has the molecular formula C6H10F2N4O2S and a molecular weight of 240.23 g/mol. Its IUPAC name is 1,1-difluoro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]methanesulfonamide.
| Compound Name | 1,1-difluoro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]methanesulfonamide |
|---|---|
| PubChem CID | 64531869 |
| Molecular Formula | C6H10F2N4O2S |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 1,1-difluoro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]methanesulfonamide |
| SMILES | O=S(=O)(NCCCc1ncn[nH]1)C(F)F |
| InChI | InChI=1S/C6H10F2N4O2S/c7-6(8)15(13,14)11-3-1-2-5-9-4-10-12-5/h4,6,11H,1-3H2,(H,9,10,12) |
| InChIKey | QJGQPSNDBYBVQW-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|