C13H14N6 — CID 64532036
N-[3-(1H-1,2,4-triazol-5-yl)propyl]phthalazin-1-amine (PubChem CID 64532036) has the molecular formula C13H14N6 and a molecular weight of 254.30 g/mol. Its IUPAC name is N-[3-(1H-1,2,4-triazol-5-yl)propyl]phthalazin-1-amine.
| Compound Name | N-[3-(1H-1,2,4-triazol-5-yl)propyl]phthalazin-1-amine |
|---|---|
| PubChem CID | 64532036 |
| Molecular Formula | C13H14N6 |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | N-[3-(1H-1,2,4-triazol-5-yl)propyl]phthalazin-1-amine |
| SMILES | c1ccc2c(NCCCc3ncn[nH]3)nncc2c1 |
| InChI | InChI=1S/C13H14N6/c1-2-5-11-10(4-1)8-16-19-13(11)14-7-3-6-12-15-9-17-18-12/h1-2,4-5,8-9H,3,6-7H2,(H,14,19)(H,15,17,18) |
| InChIKey | BFIYXNLGGJPRQJ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|