About N,N-diethylethanamine;prop-2-enoic acid
N,N-diethylethanamine;prop-2-enoic acid (PubChem CID 6453210) has the molecular formula C9H19NO2
and a molecular weight of 173.26 g/mol. Its IUPAC name is N,N-diethylethanamine;prop-2-enoic acid.
Molecular Properties
| Compound Name | N,N-diethylethanamine;prop-2-enoic acid |
| PubChem CID | 6453210 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | N,N-diethylethanamine;prop-2-enoic acid |
| SMILES | C=CC(=O)O.CCN(CC)CC |
| InChI | InChI=1S/C6H15N.C3H4O2/c1-4-7(5-2)6-3;1-2-3(4)5/h4-6H2,1-3H3;2H,1H2,(H,4,5) |
| InChIKey | CKCQRGCWKDEOSO-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethylethanamine;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;prop-2-enoic acid?
The IUPAC name of N,N-diethylethanamine;prop-2-enoic acid (CID 6453210) is N,N-diethylethanamine;prop-2-enoic acid.
What is the SMILES notation for N,N-diethylethanamine;prop-2-enoic acid?
The canonical SMILES for N,N-diethylethanamine;prop-2-enoic acid is C=CC(=O)O.CCN(CC)CC.
What is the InChIKey of N,N-diethylethanamine;prop-2-enoic acid?
The InChIKey is CKCQRGCWKDEOSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C3H4O2/c1-4-7(5-2)6-3;1-2-3(4)5/h4-6H2,1-3H3;2H,1H2,(H,4,5).
What are the key properties of N,N-diethylethanamine;prop-2-enoic acid?
N,N-diethylethanamine;prop-2-enoic acid has a molecular weight of 173.26 g/mol, XLogP of 1.61, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;prop-2-enoic acid is sourced from PubChem (CID 6453210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).