C6H12N4O2S — CID 64532113
2-[(dimethylsulfamoylamino)methyl]-1H-imidazole (PubChem CID 64532113) has the molecular formula C6H12N4O2S and a molecular weight of 204.25 g/mol. Its IUPAC name is 2-[(dimethylsulfamoylamino)methyl]-1H-imidazole.
| Compound Name | 2-[(dimethylsulfamoylamino)methyl]-1H-imidazole |
|---|---|
| PubChem CID | 64532113 |
| Molecular Formula | C6H12N4O2S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 2-[(dimethylsulfamoylamino)methyl]-1H-imidazole |
| SMILES | CN(C)S(=O)(=O)NCc1ncc[nH]1 |
| InChI | InChI=1S/C6H12N4O2S/c1-10(2)13(11,12)9-5-6-7-3-4-8-6/h3-4,9H,5H2,1-2H3,(H,7,8) |
| InChIKey | HFUVUFWLFWVSHA-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |