About 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid
2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid (PubChem CID 6453213) has the molecular formula C8H8O4
and a molecular weight of 168.15 g/mol. Its IUPAC name is 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid |
| PubChem CID | 6453213 |
| Molecular Formula | C8H8O4 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid |
| SMILES | O=C1C=CC(O)(CC(=O)O)C=C1 |
| InChI | InChI=1S/C8H8O4/c9-6-1-3-8(12,4-2-6)5-7(10)11/h1-4,12H,5H2,(H,10,11) |
| InChIKey | RFJUCKOEXRTZPN-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid?
The IUPAC name of 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid (CID 6453213) is 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid.
What is the SMILES notation for 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid?
The canonical SMILES for 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid is O=C1C=CC(O)(CC(=O)O)C=C1.
What is the InChIKey of 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid?
The InChIKey is RFJUCKOEXRTZPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O4/c9-6-1-3-8(12,4-2-6)5-7(10)11/h1-4,12H,5H2,(H,10,11).
What are the key properties of 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid?
2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid has a molecular weight of 168.15 g/mol, XLogP of -0.11, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid is sourced from PubChem (CID 6453213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).