2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid

C8H8O4 — CID 6453213

IUPAC2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid
SMILESO=C1C=CC(O)(CC(=O)O)C=C1
InChIInChI=1S/C8H8O4/c9-6-1-3-8(12,4-2-6)5-7(10)11/h1-4,12H,5H2,(H,10,11)
InChIKeyRFJUCKOEXRTZPN-UHFFFAOYSA-N
MW168.15 g/mol
LogP-0.11
Rot. Bonds2

About 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid

2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid (PubChem CID 6453213) has the molecular formula C8H8O4 and a molecular weight of 168.15 g/mol. Its IUPAC name is 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid.

Molecular Properties

Compound Name2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid
PubChem CID6453213
Molecular FormulaC8H8O4
Molecular Weight168.15 g/mol
Exact Mass168.04
IUPAC Name2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid
SMILESO=C1C=CC(O)(CC(=O)O)C=C1
InChIInChI=1S/C8H8O4/c9-6-1-3-8(12,4-2-6)5-7(10)11/h1-4,12H,5H2,(H,10,11)
InChIKeyRFJUCKOEXRTZPN-UHFFFAOYSA-N
XLogP-0.11
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.15
LogP ≤ 5-0.11
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid?
The IUPAC name of 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid (CID 6453213) is 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid.
What is the SMILES notation for 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid?
The canonical SMILES for 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid is O=C1C=CC(O)(CC(=O)O)C=C1.
What is the InChIKey of 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid?
The InChIKey is RFJUCKOEXRTZPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O4/c9-6-1-3-8(12,4-2-6)5-7(10)11/h1-4,12H,5H2,(H,10,11).
What are the key properties of 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid?
2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid has a molecular weight of 168.15 g/mol, XLogP of -0.11, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid is sourced from PubChem (CID 6453213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).