C11H9ClN4 — CID 64532464
3-chloro-4-(1H-imidazol-2-ylmethylamino)benzonitrile (PubChem CID 64532464) has the molecular formula C11H9ClN4 and a molecular weight of 232.67 g/mol. Its IUPAC name is 3-chloro-4-(1H-imidazol-2-ylmethylamino)benzonitrile.
| Compound Name | 3-chloro-4-(1H-imidazol-2-ylmethylamino)benzonitrile |
|---|---|
| PubChem CID | 64532464 |
| Molecular Formula | C11H9ClN4 |
| Molecular Weight | 232.67 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 3-chloro-4-(1H-imidazol-2-ylmethylamino)benzonitrile |
| SMILES | N#Cc1ccc(NCc2ncc[nH]2)c(Cl)c1 |
| InChI | InChI=1S/C11H9ClN4/c12-9-5-8(6-13)1-2-10(9)16-7-11-14-3-4-15-11/h1-5,16H,7H2,(H,14,15) |
| InChIKey | WNXACDPAXJHOTB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 64.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.67 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |