About ethylsulfanylethane;tetrachloroplatinum
ethylsulfanylethane;tetrachloroplatinum (PubChem CID 6453282) has the molecular formula C8H20Cl4PtS2
and a molecular weight of 517.27 g/mol. Its IUPAC name is ethylsulfanylethane;tetrachloroplatinum.
Molecular Properties
| Compound Name | ethylsulfanylethane;tetrachloroplatinum |
| PubChem CID | 6453282 |
| Molecular Formula | C8H20Cl4PtS2 |
| Molecular Weight | 517.27 g/mol |
| Exact Mass | 514.94 |
| IUPAC Name | ethylsulfanylethane;tetrachloroplatinum |
| SMILES | CCSCC.CCSCC.Cl[Pt](Cl)(Cl)Cl |
| InChI | InChI=1S/2C4H10S.4ClH.Pt/c2*1-3-5-4-2;;;;;/h2*3-4H2,1-2H3;4*1H;/q;;;;;;+4/p-4 |
| InChIKey | WPILFWLWHNPLEX-UHFFFAOYSA-J |
| XLogP | 6.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 517.27 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethylsulfanylethane;tetrachloroplatinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylsulfanylethane;tetrachloroplatinum?
The IUPAC name of ethylsulfanylethane;tetrachloroplatinum (CID 6453282) is ethylsulfanylethane;tetrachloroplatinum.
What is the SMILES notation for ethylsulfanylethane;tetrachloroplatinum?
The canonical SMILES for ethylsulfanylethane;tetrachloroplatinum is CCSCC.CCSCC.Cl[Pt](Cl)(Cl)Cl.
What is the InChIKey of ethylsulfanylethane;tetrachloroplatinum?
The InChIKey is WPILFWLWHNPLEX-UHFFFAOYSA-J. The full InChI is InChI=1S/2C4H10S.4ClH.Pt/c2*1-3-5-4-2;;;;;/h2*3-4H2,1-2H3;4*1H;/q;;;;;;+4/p-4.
What are the key properties of ethylsulfanylethane;tetrachloroplatinum?
ethylsulfanylethane;tetrachloroplatinum has a molecular weight of 517.27 g/mol, XLogP of 6.27, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethylsulfanylethane;tetrachloroplatinum is sourced from PubChem (CID 6453282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).