About prop-1-en-2-ylbenzene;styrene;tricyclo[5.2.1.02,6]deca-3,8-diene
prop-1-en-2-ylbenzene;styrene;tricyclo[5.2.1.02,6]deca-3,8-diene (PubChem CID 6453309) has the molecular formula C27H30
and a molecular weight of 354.54 g/mol. Its IUPAC name is prop-1-en-2-ylbenzene;styrene;tricyclo[5.2.1.02,6]deca-3,8-diene.
Molecular Properties
| Compound Name | prop-1-en-2-ylbenzene;styrene;tricyclo[5.2.1.02,6]deca-3,8-diene |
| PubChem CID | 6453309 |
| Molecular Formula | C27H30 |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | prop-1-en-2-ylbenzene;styrene;tricyclo[5.2.1.02,6]deca-3,8-diene |
| SMILES | C1=CC2C3C=CC(C3)C2C1.C=C(C)c1ccccc1.C=Cc1ccccc1 |
| InChI | InChI=1S/C10H12.C9H10.C8H8/c1-2-9-7-4-5-8(6-7)10(9)3-1;1-8(2)9-6-4-3-5-7-9;1-2-8-6-4-3-5-7-8/h1-2,4-5,7-10H,3,6H2;3-7H,1H2,2H3;2-7H,1H2 |
| InChIKey | FOSUQUPFLHTPQG-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-1-en-2-ylbenzene;styrene;tricyclo[5.2.1.02,6]deca-3,8-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-1-en-2-ylbenzene;styrene;tricyclo[5.2.1.02,6]deca-3,8-diene?
The IUPAC name of prop-1-en-2-ylbenzene;styrene;tricyclo[5.2.1.02,6]deca-3,8-diene (CID 6453309) is prop-1-en-2-ylbenzene;styrene;tricyclo[5.2.1.02,6]deca-3,8-diene.
What is the SMILES notation for prop-1-en-2-ylbenzene;styrene;tricyclo[5.2.1.02,6]deca-3,8-diene?
The canonical SMILES for prop-1-en-2-ylbenzene;styrene;tricyclo[5.2.1.02,6]deca-3,8-diene is C1=CC2C3C=CC(C3)C2C1.C=C(C)c1ccccc1.C=Cc1ccccc1.
What is the InChIKey of prop-1-en-2-ylbenzene;styrene;tricyclo[5.2.1.02,6]deca-3,8-diene?
The InChIKey is FOSUQUPFLHTPQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12.C9H10.C8H8/c1-2-9-7-4-5-8(6-7)10(9)3-1;1-8(2)9-6-4-3-5-7-9;1-2-8-6-4-3-5-7-8/h1-2,4-5,7-10H,3,6H2;3-7H,1H2,2H3;2-7H,1H2.
What are the key properties of prop-1-en-2-ylbenzene;styrene;tricyclo[5.2.1.02,6]deca-3,8-diene?
prop-1-en-2-ylbenzene;styrene;tricyclo[5.2.1.02,6]deca-3,8-diene has a molecular weight of 354.54 g/mol, XLogP of 7.43, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for prop-1-en-2-ylbenzene;styrene;tricyclo[5.2.1.02,6]deca-3,8-diene is sourced from PubChem (CID 6453309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).