About dioxido(dioxo)chromium;bis(tetrabutylazanium)
dioxido(dioxo)chromium;bis(tetrabutylazanium) (PubChem CID 6453374) has the molecular formula C32H72CrN2O4
and a molecular weight of 600.93 g/mol. Its IUPAC name is dioxido(dioxo)chromium;bis(tetrabutylazanium).
Molecular Properties
| Compound Name | dioxido(dioxo)chromium;bis(tetrabutylazanium) |
| PubChem CID | 6453374 |
| Molecular Formula | C32H72CrN2O4 |
| Molecular Weight | 600.93 g/mol |
| Exact Mass | 600.49 |
| IUPAC Name | dioxido(dioxo)chromium;bis(tetrabutylazanium) |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.CCCC[N+](CCCC)(CCCC)CCCC.O=[Cr](=O)([O-])[O-] |
| InChI | InChI=1S/2C16H36N.Cr.4O/c2*1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;;;;;/h2*5-16H2,1-4H3;;;;;/q2*+1;;;;2*-1 |
| InChIKey | ZWQUOQAMKSRLDH-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 600.93 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze dioxido(dioxo)chromium;bis(tetrabutylazanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxido(dioxo)chromium;bis(tetrabutylazanium)?
The IUPAC name of dioxido(dioxo)chromium;bis(tetrabutylazanium) (CID 6453374) is dioxido(dioxo)chromium;bis(tetrabutylazanium).
What is the SMILES notation for dioxido(dioxo)chromium;bis(tetrabutylazanium)?
The canonical SMILES for dioxido(dioxo)chromium;bis(tetrabutylazanium) is CCCC[N+](CCCC)(CCCC)CCCC.CCCC[N+](CCCC)(CCCC)CCCC.O=[Cr](=O)([O-])[O-].
What is the InChIKey of dioxido(dioxo)chromium;bis(tetrabutylazanium)?
The InChIKey is ZWQUOQAMKSRLDH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C16H36N.Cr.4O/c2*1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;;;;;/h2*5-16H2,1-4H3;;;;;/q2*+1;;;;2*-1.
What are the key properties of dioxido(dioxo)chromium;bis(tetrabutylazanium)?
dioxido(dioxo)chromium;bis(tetrabutylazanium) has a molecular weight of 600.93 g/mol, XLogP of 7.39, 24 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dioxido(dioxo)chromium;bis(tetrabutylazanium) is sourced from PubChem (CID 6453374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).