C12H19N3O — CID 64533818
2-(1-ethoxyethyl)-5,6,7,8-tetrahydroquinazolin-5-amine (PubChem CID 64533818) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-(1-ethoxyethyl)-5,6,7,8-tetrahydroquinazolin-5-amine.
| Compound Name | 2-(1-ethoxyethyl)-5,6,7,8-tetrahydroquinazolin-5-amine |
|---|---|
| PubChem CID | 64533818 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 2-(1-ethoxyethyl)-5,6,7,8-tetrahydroquinazolin-5-amine |
| SMILES | CCOC(C)c1ncc2c(n1)CCCC2N |
| InChI | InChI=1S/C12H19N3O/c1-3-16-8(2)12-14-7-9-10(13)5-4-6-11(9)15-12/h7-8,10H,3-6,13H2,1-2H3 |
| InChIKey | MWZHIAYSEVQFEJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |