About [3-(1-ethoxyethyl)-1H-1,2,4-triazol-5-yl]methanamine
[3-(1-ethoxyethyl)-1H-1,2,4-triazol-5-yl]methanamine (PubChem CID 64534438) has the molecular formula C7H14N4O
and a molecular weight of 170.22 g/mol. Its IUPAC name is [3-(1-ethoxyethyl)-1H-1,2,4-triazol-5-yl]methanamine.
Molecular Properties
| Compound Name | [3-(1-ethoxyethyl)-1H-1,2,4-triazol-5-yl]methanamine |
| PubChem CID | 64534438 |
| Molecular Formula | C7H14N4O |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.12 |
| IUPAC Name | [3-(1-ethoxyethyl)-1H-1,2,4-triazol-5-yl]methanamine |
| SMILES | CCOC(C)c1n[nH]c(CN)n1 |
| InChI | InChI=1S/C7H14N4O/c1-3-12-5(2)7-9-6(4-8)10-11-7/h5H,3-4,8H2,1-2H3,(H,9,10,11) |
| InChIKey | PTCSKDBEJOVVKI-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(1-ethoxyethyl)-1H-1,2,4-triazol-5-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1-ethoxyethyl)-1H-1,2,4-triazol-5-yl]methanamine?
The IUPAC name of [3-(1-ethoxyethyl)-1H-1,2,4-triazol-5-yl]methanamine (CID 64534438) is [3-(1-ethoxyethyl)-1H-1,2,4-triazol-5-yl]methanamine.
What is the SMILES notation for [3-(1-ethoxyethyl)-1H-1,2,4-triazol-5-yl]methanamine?
The canonical SMILES for [3-(1-ethoxyethyl)-1H-1,2,4-triazol-5-yl]methanamine is CCOC(C)c1n[nH]c(CN)n1.
What is the InChIKey of [3-(1-ethoxyethyl)-1H-1,2,4-triazol-5-yl]methanamine?
The InChIKey is PTCSKDBEJOVVKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N4O/c1-3-12-5(2)7-9-6(4-8)10-11-7/h5H,3-4,8H2,1-2H3,(H,9,10,11).
What are the key properties of [3-(1-ethoxyethyl)-1H-1,2,4-triazol-5-yl]methanamine?
[3-(1-ethoxyethyl)-1H-1,2,4-triazol-5-yl]methanamine has a molecular weight of 170.22 g/mol, XLogP of 0.36, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1-ethoxyethyl)-1H-1,2,4-triazol-5-yl]methanamine is sourced from PubChem (CID 64534438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).