About 2,4-dichloro-6-[(3,5-dichloro-2-hydroxyphenyl)disulfanyl]phenol
2,4-dichloro-6-[(3,5-dichloro-2-hydroxyphenyl)disulfanyl]phenol (PubChem CID 6453504) has the molecular formula C12H6Cl4O2S2
and a molecular weight of 388.12 g/mol. Its IUPAC name is 2,4-dichloro-6-[(3,5-dichloro-2-hydroxyphenyl)disulfanyl]phenol.
Molecular Properties
| Compound Name | 2,4-dichloro-6-[(3,5-dichloro-2-hydroxyphenyl)disulfanyl]phenol |
| PubChem CID | 6453504 |
| Molecular Formula | C12H6Cl4O2S2 |
| Molecular Weight | 388.12 g/mol |
| Exact Mass | 385.86 |
| IUPAC Name | 2,4-dichloro-6-[(3,5-dichloro-2-hydroxyphenyl)disulfanyl]phenol |
| SMILES | Oc1c(Cl)cc(Cl)cc1SSc1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C12H6Cl4O2S2/c13-5-1-7(15)11(17)9(3-5)19-20-10-4-6(14)2-8(16)12(10)18/h1-4,17-18H |
| InChIKey | YVALZDKTCRMZLQ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.12 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dichloro-6-[(3,5-dichloro-2-hydroxyphenyl)disulfanyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-6-[(3,5-dichloro-2-hydroxyphenyl)disulfanyl]phenol?
The IUPAC name of 2,4-dichloro-6-[(3,5-dichloro-2-hydroxyphenyl)disulfanyl]phenol (CID 6453504) is 2,4-dichloro-6-[(3,5-dichloro-2-hydroxyphenyl)disulfanyl]phenol.
What is the SMILES notation for 2,4-dichloro-6-[(3,5-dichloro-2-hydroxyphenyl)disulfanyl]phenol?
The canonical SMILES for 2,4-dichloro-6-[(3,5-dichloro-2-hydroxyphenyl)disulfanyl]phenol is Oc1c(Cl)cc(Cl)cc1SSc1cc(Cl)cc(Cl)c1O.
What is the InChIKey of 2,4-dichloro-6-[(3,5-dichloro-2-hydroxyphenyl)disulfanyl]phenol?
The InChIKey is YVALZDKTCRMZLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6Cl4O2S2/c13-5-1-7(15)11(17)9(3-5)19-20-10-4-6(14)2-8(16)12(10)18/h1-4,17-18H.
What are the key properties of 2,4-dichloro-6-[(3,5-dichloro-2-hydroxyphenyl)disulfanyl]phenol?
2,4-dichloro-6-[(3,5-dichloro-2-hydroxyphenyl)disulfanyl]phenol has a molecular weight of 388.12 g/mol, XLogP of 6.51, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-6-[(3,5-dichloro-2-hydroxyphenyl)disulfanyl]phenol is sourced from PubChem (CID 6453504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).