About methyl 5-[(4-amino-5-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl]furan-2-carboxylate
methyl 5-[(4-amino-5-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl]furan-2-carboxylate (PubChem CID 645352) has the molecular formula C11H14N4O3S
and a molecular weight of 282.32 g/mol. Its IUPAC name is methyl 5-[(4-amino-5-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl]furan-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[(4-amino-5-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl]furan-2-carboxylate |
| PubChem CID | 645352 |
| Molecular Formula | C11H14N4O3S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | methyl 5-[(4-amino-5-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl]furan-2-carboxylate |
| SMILES | CCc1nnc(SCc2ccc(C(=O)OC)o2)n1N |
| InChI | InChI=1S/C11H14N4O3S/c1-3-9-13-14-11(15(9)12)19-6-7-4-5-8(18-7)10(16)17-2/h4-5H,3,6,12H2,1-2H3 |
| InChIKey | FSISNKIJFLVJCO-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze methyl 5-[(4-amino-5-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl]furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[(4-amino-5-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl]furan-2-carboxylate?
The IUPAC name of methyl 5-[(4-amino-5-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl]furan-2-carboxylate (CID 645352) is methyl 5-[(4-amino-5-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl]furan-2-carboxylate.
What is the SMILES notation for methyl 5-[(4-amino-5-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl]furan-2-carboxylate?
The canonical SMILES for methyl 5-[(4-amino-5-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl]furan-2-carboxylate is CCc1nnc(SCc2ccc(C(=O)OC)o2)n1N.
What is the InChIKey of methyl 5-[(4-amino-5-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl]furan-2-carboxylate?
The InChIKey is FSISNKIJFLVJCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O3S/c1-3-9-13-14-11(15(9)12)19-6-7-4-5-8(18-7)10(16)17-2/h4-5H,3,6,12H2,1-2H3.
What are the key properties of methyl 5-[(4-amino-5-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl]furan-2-carboxylate?
methyl 5-[(4-amino-5-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl]furan-2-carboxylate has a molecular weight of 282.32 g/mol, XLogP of 1.23, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[(4-amino-5-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl]furan-2-carboxylate is sourced from PubChem (CID 645352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).