C12H19N4O5PS — CID 6453587
2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethanol;dihydrogen phosphate (PubChem CID 6453587) has the molecular formula C12H19N4O5PS and a molecular weight of 362.35 g/mol. Its IUPAC name is 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethanol;dihydrogen phosphate.
| Compound Name | 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethanol;dihydrogen phosphate |
|---|---|
| PubChem CID | 6453587 |
| Molecular Formula | C12H19N4O5PS |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethanol;dihydrogen phosphate |
| SMILES | Cc1ncc(C[n+]2csc(CCO)c2C)c(N)n1.O=P([O-])(O)O |
| InChI | InChI=1S/C12H17N4OS.H3O4P/c1-8-11(3-4-17)18-7-16(8)6-10-5-14-9(2)15-12(10)13;1-5(2,3)4/h5,7,17H,3-4,6H2,1-2H3,(H2,13,14,15);(H3,1,2,3,4)/q+1;/p-1 |
| InChIKey | UKFDLENPEYTYDQ-UHFFFAOYSA-M |
| XLogP | -0.95 |
| TPSA | 156.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|