C15H22N2S — CID 64535909
3-(cyclopentylmethylsulfanyl)-2-phenylpropanimidamide (PubChem CID 64535909) has the molecular formula C15H22N2S and a molecular weight of 262.42 g/mol. Its IUPAC name is 3-(cyclopentylmethylsulfanyl)-2-phenylpropanimidamide.
| Compound Name | 3-(cyclopentylmethylsulfanyl)-2-phenylpropanimidamide |
|---|---|
| PubChem CID | 64535909 |
| Molecular Formula | C15H22N2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 3-(cyclopentylmethylsulfanyl)-2-phenylpropanimidamide |
| SMILES | [H]/N=C(\N)C(CSCC1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C15H22N2S/c16-15(17)14(13-8-2-1-3-9-13)11-18-10-12-6-4-5-7-12/h1-3,8-9,12,14H,4-7,10-11H2,(H3,16,17) |
| InChIKey | NCEFYNRNLGZOQF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|