C22H22ClNO8 — CID 6453629
(6-methoxy-3,3,12-trimethylpyrano[2,3-c]acridin-12-ium-7-yl) acetate perchlorate (PubChem CID 6453629) has the molecular formula C22H22ClNO8 and a molecular weight of 463.87 g/mol. Its IUPAC name is (6-methoxy-3,3,12-trimethylpyrano[2,3-c]acridin-12-ium-7-yl) acetate perchlorate.
| Compound Name | (6-methoxy-3,3,12-trimethylpyrano[2,3-c]acridin-12-ium-7-yl) acetate perchlorate |
|---|---|
| PubChem CID | 6453629 |
| Molecular Formula | C22H22ClNO8 |
| Molecular Weight | 463.87 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | (6-methoxy-3,3,12-trimethylpyrano[2,3-c]acridin-12-ium-7-yl) acetate perchlorate |
| SMILES | COc1cc2c(c3c1c(OC(C)=O)c1ccccc1[n+]3C)C=CC(C)(C)O2.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C22H22NO4.ClHO4/c1-13(24)26-21-14-8-6-7-9-16(14)23(4)20-15-10-11-22(2,3)27-17(15)12-18(25-5)19(20)21;2-1(3,4)5/h6-12H,1-5H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | HPVKFLSDXNORHH-UHFFFAOYSA-M |
| XLogP | -0.82 |
| TPSA | 140.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.87 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|